C22H31N3O3 — CID 167071320
N-[3-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-6-methyl-3-methylidenenonanamide (PubChem CID 167071320) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[3-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-6-methyl-3-methylidenenonanamide.
| Compound Name | N-[3-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-6-methyl-3-methylidenenonanamide |
|---|---|
| PubChem CID | 167071320 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[3-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-6-methyl-3-methylidenenonanamide |
| SMILES | C=C(CCC(C)CCC)CC(=O)Nc1cccc(NC2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H31N3O3/c1-4-6-15(2)9-10-16(3)13-21(27)24-18-8-5-7-17(14-18)23-19-11-12-20(26)25-22(19)28/h5,7-8,14-15,19,23H,3-4,6,9-13H2,1-2H3,(H,24,27)(H,25,26,28) |
| InChIKey | QUMJOBNKRZEICY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|