C12H15Cl2N3O2 — CID 169082326
3-(3-aminoanilino)piperidine-2,6-dione;dichloromethane (PubChem CID 169082326) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 3-(3-aminoanilino)piperidine-2,6-dione;dichloromethane.
| Compound Name | 3-(3-aminoanilino)piperidine-2,6-dione;dichloromethane |
|---|---|
| PubChem CID | 169082326 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-(3-aminoanilino)piperidine-2,6-dione;dichloromethane |
| SMILES | ClCCl.Nc1cccc(NC2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H13N3O2.CH2Cl2/c12-7-2-1-3-8(6-7)13-9-4-5-10(15)14-11(9)16;2-1-3/h1-3,6,9,13H,4-5,12H2,(H,14,15,16);1H2 |
| InChIKey | NVCXFKMUHQHBIB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|