C11H11KN2O2 — CID 169190282
potassium 3-(anilino)piperidine-2,6-dione (PubChem CID 169190282) has the molecular formula C11H11KN2O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is potassium 3-(anilino)piperidine-2,6-dione.
| Compound Name | potassium 3-(anilino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169190282 |
| Molecular Formula | C11H11KN2O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | potassium 3-(anilino)piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2cc[c-]cc2)C(=O)N1.[K+] |
| InChI | InChI=1S/C11H11N2O2.K/c14-10-7-6-9(11(15)13-10)12-8-4-2-1-3-5-8;/h2-5,9,12H,6-7H2,(H,13,14,15);/q-1;+1 |
| InChIKey | WUHVKZXNZKSKJW-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|