C16H20N4O2 — CID 170749022
3-[4-(3,6-diazabicyclo[3.1.1]heptan-3-yl)anilino]piperidine-2,6-dione (PubChem CID 170749022) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[4-(3,6-diazabicyclo[3.1.1]heptan-3-yl)anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-(3,6-diazabicyclo[3.1.1]heptan-3-yl)anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170749022 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-[4-(3,6-diazabicyclo[3.1.1]heptan-3-yl)anilino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CC4CC(C3)N4)cc2)C(=O)N1 |
| InChI | InChI=1S/C16H20N4O2/c21-15-6-5-14(16(22)19-15)18-10-1-3-13(4-2-10)20-8-11-7-12(9-20)17-11/h1-4,11-12,14,17-18H,5-9H2,(H,19,21,22) |
| InChIKey | TZYKQEVTSCLEAZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|