C15H17N3O3 — CID 167164739
1-(3-aminophenyl)-N-(2,6-dioxopiperidin-3-yl)cyclopropane-1-carboxamide (PubChem CID 167164739) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-(3-aminophenyl)-N-(2,6-dioxopiperidin-3-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-(3-aminophenyl)-N-(2,6-dioxopiperidin-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 167164739 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(3-aminophenyl)-N-(2,6-dioxopiperidin-3-yl)cyclopropane-1-carboxamide |
| SMILES | Nc1cccc(C2(C(=O)NC3CCC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C15H17N3O3/c16-10-3-1-2-9(8-10)15(6-7-15)14(21)17-11-4-5-12(19)18-13(11)20/h1-3,8,11H,4-7,16H2,(H,17,21)(H,18,19,20) |
| InChIKey | JSUJBIKXQCSIOM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|