C23H38N4O2 — CID 166468015
ethane;3-[3-[[4-[methyl(propan-2-yl)amino]piperidin-1-yl]methyl]anilino]piperidine-2,6-dione (PubChem CID 166468015) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is ethane;3-[3-[[4-[methyl(propan-2-yl)amino]piperidin-1-yl]methyl]anilino]piperidine-2,6-dione.
| Compound Name | ethane;3-[3-[[4-[methyl(propan-2-yl)amino]piperidin-1-yl]methyl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166468015 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | ethane;3-[3-[[4-[methyl(propan-2-yl)amino]piperidin-1-yl]methyl]anilino]piperidine-2,6-dione |
| SMILES | CC.CC(C)N(C)C1CCN(Cc2cccc(NC3CCC(=O)NC3=O)c2)CC1 |
| InChI | InChI=1S/C21H32N4O2.C2H6/c1-15(2)24(3)18-9-11-25(12-10-18)14-16-5-4-6-17(13-16)22-19-7-8-20(26)23-21(19)27;1-2/h4-6,13,15,18-19,22H,7-12,14H2,1-3H3,(H,23,26,27);1-2H3 |
| InChIKey | UETFNJZPKHUSJC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|