C23H26BrN5O5 — CID 166095534
3-[3-[[4-(2-bromo-5-methoxy-4-nitrophenyl)piperazin-1-yl]methyl]anilino]piperidine-2,6-dione (PubChem CID 166095534) has the molecular formula C23H26BrN5O5 and a molecular weight of 532.40 g/mol. Its IUPAC name is 3-[3-[[4-(2-bromo-5-methoxy-4-nitrophenyl)piperazin-1-yl]methyl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[3-[[4-(2-bromo-5-methoxy-4-nitrophenyl)piperazin-1-yl]methyl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166095534 |
| Molecular Formula | C23H26BrN5O5 |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 3-[3-[[4-(2-bromo-5-methoxy-4-nitrophenyl)piperazin-1-yl]methyl]anilino]piperidine-2,6-dione |
| SMILES | COc1cc(N2CCN(Cc3cccc(NC4CCC(=O)NC4=O)c3)CC2)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26BrN5O5/c1-34-21-13-19(17(24)12-20(21)29(32)33)28-9-7-27(8-10-28)14-15-3-2-4-16(11-15)25-18-5-6-22(30)26-23(18)31/h2-4,11-13,18,25H,5-10,14H2,1H3,(H,26,30,31) |
| InChIKey | HQFCUZSDTDSAHM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|