C15H20BrN3O3 — CID 154588578
7-(2-bromo-5-methoxy-4-nitrophenyl)-2-methyl-2,7-diazaspiro[3.5]nonane (PubChem CID 154588578) has the molecular formula C15H20BrN3O3 and a molecular weight of 370.25 g/mol. Its IUPAC name is 7-(2-bromo-5-methoxy-4-nitrophenyl)-2-methyl-2,7-diazaspiro[3.5]nonane.
| Compound Name | 7-(2-bromo-5-methoxy-4-nitrophenyl)-2-methyl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 154588578 |
| Molecular Formula | C15H20BrN3O3 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 7-(2-bromo-5-methoxy-4-nitrophenyl)-2-methyl-2,7-diazaspiro[3.5]nonane |
| SMILES | COc1cc(N2CCC3(CC2)CN(C)C3)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20BrN3O3/c1-17-9-15(10-17)3-5-18(6-4-15)12-8-14(22-2)13(19(20)21)7-11(12)16/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | PNDVDBZBPZVGEV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|