C14H18BrN3O3 — CID 167322894
(3aS,6aR)-5-(2-bromo-5-methoxy-4-nitrophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 167322894) has the molecular formula C14H18BrN3O3 and a molecular weight of 356.22 g/mol. Its IUPAC name is (3aS,6aR)-5-(2-bromo-5-methoxy-4-nitrophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-(2-bromo-5-methoxy-4-nitrophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 167322894 |
| Molecular Formula | C14H18BrN3O3 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | (3aS,6aR)-5-(2-bromo-5-methoxy-4-nitrophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | COc1cc(N2C[C@H]3CN(C)C[C@H]3C2)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18BrN3O3/c1-16-5-9-7-17(8-10(9)6-16)12-4-14(21-2)13(18(19)20)3-11(12)15/h3-4,9-10H,5-8H2,1-2H3/t9-,10+ |
| InChIKey | IPGACHSXZLRINJ-AOOOYVTPSA-N |
| XLogP | 2.36 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|