C14H17BrN2O5 — CID 175374876
methyl 4-bromo-5-(2,6-dimethylmorpholin-4-yl)-2-nitrobenzoate (PubChem CID 175374876) has the molecular formula C14H17BrN2O5 and a molecular weight of 373.20 g/mol. Its IUPAC name is methyl 4-bromo-5-(2,6-dimethylmorpholin-4-yl)-2-nitrobenzoate.
| Compound Name | methyl 4-bromo-5-(2,6-dimethylmorpholin-4-yl)-2-nitrobenzoate |
|---|---|
| PubChem CID | 175374876 |
| Molecular Formula | C14H17BrN2O5 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | methyl 4-bromo-5-(2,6-dimethylmorpholin-4-yl)-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(N2CC(C)OC(C)C2)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17BrN2O5/c1-8-6-16(7-9(2)22-8)13-4-10(14(18)21-3)12(17(19)20)5-11(13)15/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | SRVRDXZQHRQVTC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|