C13H14N2O5 — CID 165178718
methyl 5-nitro-1-(oxetan-3-yl)-2,3-dihydroindole-6-carboxylate (PubChem CID 165178718) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is methyl 5-nitro-1-(oxetan-3-yl)-2,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 5-nitro-1-(oxetan-3-yl)-2,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 165178718 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | methyl 5-nitro-1-(oxetan-3-yl)-2,3-dihydroindole-6-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1[N+](=O)[O-])CCN2C1COC1 |
| InChI | InChI=1S/C13H14N2O5/c1-19-13(16)10-5-11-8(4-12(10)15(17)18)2-3-14(11)9-6-20-7-9/h4-5,9H,2-3,6-7H2,1H3 |
| InChIKey | VTPGECMKFDMWCE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|