C13H13FN2O5 — CID 176888799
methyl 4-fluoro-2-nitro-5-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]benzoate (PubChem CID 176888799) has the molecular formula C13H13FN2O5 and a molecular weight of 296.25 g/mol. Its IUPAC name is methyl 4-fluoro-2-nitro-5-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]benzoate.
| Compound Name | methyl 4-fluoro-2-nitro-5-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]benzoate |
|---|---|
| PubChem CID | 176888799 |
| Molecular Formula | C13H13FN2O5 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | methyl 4-fluoro-2-nitro-5-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]benzoate |
| SMILES | COC(=O)c1cc(N2C[C@@H]3C[C@H]2CO3)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13FN2O5/c1-20-13(17)9-3-12(10(14)4-11(9)16(18)19)15-5-8-2-7(15)6-21-8/h3-4,7-8H,2,5-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | GXAAUNPSZDHUOQ-YUMQZZPRSA-N |
| XLogP | 1.50 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|