C22H33N5O3 — CID 170042265
2-[(2S,6R)-2,6-dimethyl-4-propylpiperazin-1-yl]-N-[3-[[(3S)-2,6-dioxopiperidin-3-yl]amino]phenyl]acetamide (PubChem CID 170042265) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethyl-4-propylpiperazin-1-yl]-N-[3-[[(3S)-2,6-dioxopiperidin-3-yl]amino]phenyl]acetamide.
| Compound Name | 2-[(2S,6R)-2,6-dimethyl-4-propylpiperazin-1-yl]-N-[3-[[(3S)-2,6-dioxopiperidin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 170042265 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethyl-4-propylpiperazin-1-yl]-N-[3-[[(3S)-2,6-dioxopiperidin-3-yl]amino]phenyl]acetamide |
| SMILES | CCCN1C[C@@H](C)N(CC(=O)Nc2cccc(N[C@H]3CCC(=O)NC3=O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C22H33N5O3/c1-4-10-26-12-15(2)27(16(3)13-26)14-21(29)24-18-7-5-6-17(11-18)23-19-8-9-20(28)25-22(19)30/h5-7,11,15-16,19,23H,4,8-10,12-14H2,1-3H3,(H,24,29)(H,25,28,30)/t15-,16+,19-/m0/s1 |
| InChIKey | QOMSCZRWQAJTEC-FCEWJHQRSA-N |
| XLogP | 1.65 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|