C24H34N4O5 — CID 166553640
tert-butyl (3R,5S)-4-[2-[3-(2,6-dioxopiperidin-3-yl)anilino]-2-oxoethyl]-3,5-dimethylpiperazine-1-carboxylate (PubChem CID 166553640) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is tert-butyl (3R,5S)-4-[2-[3-(2,6-dioxopiperidin-3-yl)anilino]-2-oxoethyl]-3,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-4-[2-[3-(2,6-dioxopiperidin-3-yl)anilino]-2-oxoethyl]-3,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 166553640 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | tert-butyl (3R,5S)-4-[2-[3-(2,6-dioxopiperidin-3-yl)anilino]-2-oxoethyl]-3,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H](C)N1CC(=O)Nc1cccc(C2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C24H34N4O5/c1-15-12-27(23(32)33-24(3,4)5)13-16(2)28(15)14-21(30)25-18-8-6-7-17(11-18)19-9-10-20(29)26-22(19)31/h6-8,11,15-16,19H,9-10,12-14H2,1-5H3,(H,25,30)(H,26,29,31)/t15-,16+,19? |
| InChIKey | IWTHLBOSXSDYKN-MCPYQZEQSA-N |
| XLogP | 2.47 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|