C19H22F3N5O5 — CID 175394761
(3R)-4-[2-[3-[(2,6-dioxopiperidin-3-yl)amino]anilino]-2-oxoethyl]-3-(trifluoromethyl)piperazine-1-carboxylic acid (PubChem CID 175394761) has the molecular formula C19H22F3N5O5 and a molecular weight of 457.41 g/mol. Its IUPAC name is (3R)-4-[2-[3-[(2,6-dioxopiperidin-3-yl)amino]anilino]-2-oxoethyl]-3-(trifluoromethyl)piperazine-1-carboxylic acid.
| Compound Name | (3R)-4-[2-[3-[(2,6-dioxopiperidin-3-yl)amino]anilino]-2-oxoethyl]-3-(trifluoromethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175394761 |
| Molecular Formula | C19H22F3N5O5 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (3R)-4-[2-[3-[(2,6-dioxopiperidin-3-yl)amino]anilino]-2-oxoethyl]-3-(trifluoromethyl)piperazine-1-carboxylic acid |
| SMILES | O=C1CCC(Nc2cccc(NC(=O)CN3CCN(C(=O)O)C[C@@H]3C(F)(F)F)c2)C(=O)N1 |
| InChI | InChI=1S/C19H22F3N5O5/c20-19(21,22)14-9-27(18(31)32)7-6-26(14)10-16(29)24-12-3-1-2-11(8-12)23-13-4-5-15(28)25-17(13)30/h1-3,8,13-14,23H,4-7,9-10H2,(H,24,29)(H,31,32)(H,25,28,30)/t13?,14-/m1/s1 |
| InChIKey | JLYKPNQDPJPXME-ARLHGKGLSA-N |
| XLogP | 1.07 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|