C18H21ClF3N5O3 — CID 162510374
N-[3-chloro-5-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-2-[(2R)-2-(trifluoromethyl)piperazin-1-yl]acetamide (PubChem CID 162510374) has the molecular formula C18H21ClF3N5O3 and a molecular weight of 447.85 g/mol. Its IUPAC name is N-[3-chloro-5-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-2-[(2R)-2-(trifluoromethyl)piperazin-1-yl]acetamide.
| Compound Name | N-[3-chloro-5-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-2-[(2R)-2-(trifluoromethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 162510374 |
| Molecular Formula | C18H21ClF3N5O3 |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[3-chloro-5-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-2-[(2R)-2-(trifluoromethyl)piperazin-1-yl]acetamide |
| SMILES | O=C1CCC(Nc2cc(Cl)cc(NC(=O)CN3CCNC[C@@H]3C(F)(F)F)c2)C(=O)N1 |
| InChI | InChI=1S/C18H21ClF3N5O3/c19-10-5-11(24-13-1-2-15(28)26-17(13)30)7-12(6-10)25-16(29)9-27-4-3-23-8-14(27)18(20,21)22/h5-7,13-14,23-24H,1-4,8-9H2,(H,25,29)(H,26,28,30)/t13?,14-/m1/s1 |
| InChIKey | WEJWMYLGXVAGSG-ARLHGKGLSA-N |
| XLogP | 1.33 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|