About 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile
2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile (PubChem CID 116980138) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile |
| PubChem CID | 116980138 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile |
| SMILES | COc1ccc(C2CN(CC#N)C(=O)N2)cc1OC |
| InChI | InChI=1S/C13H15N3O3/c1-18-11-4-3-9(7-12(11)19-2)10-8-16(6-5-14)13(17)15-10/h3-4,7,10H,6,8H2,1-2H3,(H,15,17) |
| InChIKey | LBPMFGXAWOSETC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile?
The IUPAC name of 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile (CID 116980138) is 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile.
What is the SMILES notation for 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile?
The canonical SMILES for 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile is COc1ccc(C2CN(CC#N)C(=O)N2)cc1OC.
What is the InChIKey of 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile?
The InChIKey is LBPMFGXAWOSETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-18-11-4-3-9(7-12(11)19-2)10-8-16(6-5-14)13(17)15-10/h3-4,7,10H,6,8H2,1-2H3,(H,15,17).
What are the key properties of 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile?
2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile has a molecular weight of 261.28 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile is sourced from PubChem (CID 116980138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).