C12H12ClN3O2 — CID 116980032
4-(3-chloro-4-ethoxyphenyl)-2-oxoimidazolidine-1-carbonitrile (PubChem CID 116980032) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 4-(3-chloro-4-ethoxyphenyl)-2-oxoimidazolidine-1-carbonitrile.
| Compound Name | 4-(3-chloro-4-ethoxyphenyl)-2-oxoimidazolidine-1-carbonitrile |
|---|---|
| PubChem CID | 116980032 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 4-(3-chloro-4-ethoxyphenyl)-2-oxoimidazolidine-1-carbonitrile |
| SMILES | CCOc1ccc(C2CN(C#N)C(=O)N2)cc1Cl |
| InChI | InChI=1S/C12H12ClN3O2/c1-2-18-11-4-3-8(5-9(11)13)10-6-16(7-14)12(17)15-10/h3-5,10H,2,6H2,1H3,(H,15,17) |
| InChIKey | XHBZYTFVCIEMRZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|