C13H15N3O2 — CID 116980017
4-(4-methoxy-2,5-dimethylphenyl)-2-oxoimidazolidine-1-carbonitrile (PubChem CID 116980017) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-(4-methoxy-2,5-dimethylphenyl)-2-oxoimidazolidine-1-carbonitrile.
| Compound Name | 4-(4-methoxy-2,5-dimethylphenyl)-2-oxoimidazolidine-1-carbonitrile |
|---|---|
| PubChem CID | 116980017 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-(4-methoxy-2,5-dimethylphenyl)-2-oxoimidazolidine-1-carbonitrile |
| SMILES | COc1cc(C)c(C2CN(C#N)C(=O)N2)cc1C |
| InChI | InChI=1S/C13H15N3O2/c1-8-5-12(18-3)9(2)4-10(8)11-6-16(7-14)13(17)15-11/h4-5,11H,6H2,1-3H3,(H,15,17) |
| InChIKey | AJJGKBCBVCLUJK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|