C11H15NO2 — CID 55263982
(2S)-2-(4,5-dimethoxy-2-methylphenyl)aziridine (PubChem CID 55263982) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (2S)-2-(4,5-dimethoxy-2-methylphenyl)aziridine.
| Compound Name | (2S)-2-(4,5-dimethoxy-2-methylphenyl)aziridine |
|---|---|
| PubChem CID | 55263982 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2S)-2-(4,5-dimethoxy-2-methylphenyl)aziridine |
| SMILES | COc1cc(C)c([C@H]2CN2)cc1OC |
| InChI | InChI=1S/C11H15NO2/c1-7-4-10(13-2)11(14-3)5-8(7)9-6-12-9/h4-5,9,12H,6H2,1-3H3/t9-/m1/s1 |
| InChIKey | PCNRVCSCCCXPGP-SECBINFHSA-N |
| XLogP | 1.66 |
| TPSA | 40.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|