C13H19NO — CID 116822126
2-(2-methoxy-4,5-dimethylphenyl)-3-methylazetidine (PubChem CID 116822126) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-(2-methoxy-4,5-dimethylphenyl)-3-methylazetidine.
| Compound Name | 2-(2-methoxy-4,5-dimethylphenyl)-3-methylazetidine |
|---|---|
| PubChem CID | 116822126 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-(2-methoxy-4,5-dimethylphenyl)-3-methylazetidine |
| SMILES | COc1cc(C)c(C)cc1C1NCC1C |
| InChI | InChI=1S/C13H19NO/c1-8-5-11(13-10(3)7-14-13)12(15-4)6-9(8)2/h5-6,10,13-14H,7H2,1-4H3 |
| InChIKey | SGPYCXWYSHRJTB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |