C13H17NO2 — CID 83837131
2-(2-methoxy-4,5-dimethylphenyl)pyrrolidin-3-one (PubChem CID 83837131) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(2-methoxy-4,5-dimethylphenyl)pyrrolidin-3-one.
| Compound Name | 2-(2-methoxy-4,5-dimethylphenyl)pyrrolidin-3-one |
|---|---|
| PubChem CID | 83837131 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(2-methoxy-4,5-dimethylphenyl)pyrrolidin-3-one |
| SMILES | COc1cc(C)c(C)cc1C1NCCC1=O |
| InChI | InChI=1S/C13H17NO2/c1-8-6-10(12(16-3)7-9(8)2)13-11(15)4-5-14-13/h6-7,13-14H,4-5H2,1-3H3 |
| InChIKey | JGTLDGXAOHRSKX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |