C13H15N3O3 — CID 116980140
2-[4-(2,5-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile (PubChem CID 116980140) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[4-(2,5-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile.
| Compound Name | 2-[4-(2,5-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 116980140 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[4-(2,5-dimethoxyphenyl)-2-oxoimidazolidin-1-yl]acetonitrile |
| SMILES | COc1ccc(OC)c(C2CN(CC#N)C(=O)N2)c1 |
| InChI | InChI=1S/C13H15N3O3/c1-18-9-3-4-12(19-2)10(7-9)11-8-16(6-5-14)13(17)15-11/h3-4,7,11H,6,8H2,1-2H3,(H,15,17) |
| InChIKey | UMEVYLPAKNTOAP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|