C14H21NO3S — CID 66224688
3-(2,5-dimethoxyphenyl)-7-methyl-1,4-thiazepane 1-oxide (PubChem CID 66224688) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-7-methyl-1,4-thiazepane 1-oxide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-7-methyl-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 66224688 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-7-methyl-1,4-thiazepane 1-oxide |
| SMILES | COc1ccc(OC)c(C2CS(=O)C(C)CCN2)c1 |
| InChI | InChI=1S/C14H21NO3S/c1-10-6-7-15-13(9-19(10)16)12-8-11(17-2)4-5-14(12)18-3/h4-5,8,10,13,15H,6-7,9H2,1-3H3 |
| InChIKey | IMBDJGFWMSLROQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |