C11H14ClNO4 — CID 171184283
(4R)-4-(2,5-dimethoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 171184283) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is (4R)-4-(2,5-dimethoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | (4R)-4-(2,5-dimethoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 171184283 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (4R)-4-(2,5-dimethoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | COc1ccc(OC)c([C@@H]2COC(=O)N2)c1.Cl |
| InChI | InChI=1S/C11H13NO4.ClH/c1-14-7-3-4-10(15-2)8(5-7)9-6-16-11(13)12-9;/h3-5,9H,6H2,1-2H3,(H,12,13);1H/t9-;/m0./s1 |
| InChIKey | ZWZBPZUZACVLJY-FVGYRXGTSA-N |
| XLogP | 1.91 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |