C11H12ClNO4 — CID 171183810
(4S)-4-(2-chloro-3,4-dimethoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 171183810) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is (4S)-4-(2-chloro-3,4-dimethoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(2-chloro-3,4-dimethoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171183810 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (4S)-4-(2-chloro-3,4-dimethoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc([C@H]2COC(=O)N2)c(Cl)c1OC |
| InChI | InChI=1S/C11H12ClNO4/c1-15-8-4-3-6(9(12)10(8)16-2)7-5-17-11(14)13-7/h3-4,7H,5H2,1-2H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | BAOJMIUUIJHTSB-SSDOTTSWSA-N |
| XLogP | 2.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |