C13H15N3OS — CID 116980185
2-[4-(4-ethylsulfanylphenyl)-2-oxoimidazolidin-1-yl]acetonitrile (PubChem CID 116980185) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-[4-(4-ethylsulfanylphenyl)-2-oxoimidazolidin-1-yl]acetonitrile.
| Compound Name | 2-[4-(4-ethylsulfanylphenyl)-2-oxoimidazolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 116980185 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[4-(4-ethylsulfanylphenyl)-2-oxoimidazolidin-1-yl]acetonitrile |
| SMILES | CCSc1ccc(C2CN(CC#N)C(=O)N2)cc1 |
| InChI | InChI=1S/C13H15N3OS/c1-2-18-11-5-3-10(4-6-11)12-9-16(8-7-14)13(17)15-12/h3-6,12H,2,8-9H2,1H3,(H,15,17) |
| InChIKey | INIHFTRVAUWGCV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|