C16H15Cl2NO — CID 4030730
4,6-dichloro-2-(2-ethoxyphenyl)-2,3-dihydro-1H-indole (PubChem CID 4030730) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 4,6-dichloro-2-(2-ethoxyphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 4,6-dichloro-2-(2-ethoxyphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4030730 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4,6-dichloro-2-(2-ethoxyphenyl)-2,3-dihydro-1H-indole |
| SMILES | CCOc1ccccc1C1Cc2c(Cl)cc(Cl)cc2N1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-2-20-16-6-4-3-5-11(16)15-9-12-13(18)7-10(17)8-14(12)19-15/h3-8,15,19H,2,9H2,1H3 |
| InChIKey | YSRIUGYGKRLTNC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |