C13H11ClN2O — CID 116837709
6-chloro-3-pyridin-3-yl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116837709) has the molecular formula C13H11ClN2O and a molecular weight of 246.70 g/mol. Its IUPAC name is 6-chloro-3-pyridin-3-yl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6-chloro-3-pyridin-3-yl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 116837709 |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 6-chloro-3-pyridin-3-yl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Clc1ccc2c(c1)NC(c1cccnc1)CO2 |
| InChI | InChI=1S/C13H11ClN2O/c14-10-3-4-13-11(6-10)16-12(8-17-13)9-2-1-5-15-7-9/h1-7,12,16H,8H2 |
| InChIKey | LQZWSIPEEQDLBH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |