C10H15N3O — CID 84619167
3-(2-aminoethyl)-3,4-dihydro-2H-1,4-benzoxazin-7-amine (PubChem CID 84619167) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(2-aminoethyl)-3,4-dihydro-2H-1,4-benzoxazin-7-amine.
| Compound Name | 3-(2-aminoethyl)-3,4-dihydro-2H-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 84619167 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-(2-aminoethyl)-3,4-dihydro-2H-1,4-benzoxazin-7-amine |
| SMILES | NCCC1COc2cc(N)ccc2N1 |
| InChI | InChI=1S/C10H15N3O/c11-4-3-8-6-14-10-5-7(12)1-2-9(10)13-8/h1-2,5,8,13H,3-4,6,11-12H2 |
| InChIKey | LXQQJJSKHZZAEF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|