C9H10ClNO — CID 92966039
(3R)-7-chloro-3,4-dihydro-2H-chromen-3-amine (PubChem CID 92966039) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is (3R)-7-chloro-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | (3R)-7-chloro-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 92966039 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (3R)-7-chloro-3,4-dihydro-2H-chromen-3-amine |
| SMILES | N[C@H]1COc2cc(Cl)ccc2C1 |
| InChI | InChI=1S/C9H10ClNO/c10-7-2-1-6-3-8(11)5-12-9(6)4-7/h1-2,4,8H,3,5,11H2/t8-/m1/s1 |
| InChIKey | SFCGCBIKHFWQOV-MRVPVSSYSA-N |
| XLogP | 1.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |