C9H9ClFNO — CID 137480705
(3S)-7-chloro-8-fluoro-3,4-dihydro-2H-chromen-3-amine (PubChem CID 137480705) has the molecular formula C9H9ClFNO and a molecular weight of 201.63 g/mol. Its IUPAC name is (3S)-7-chloro-8-fluoro-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | (3S)-7-chloro-8-fluoro-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 137480705 |
| Molecular Formula | C9H9ClFNO |
| Molecular Weight | 201.63 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (3S)-7-chloro-8-fluoro-3,4-dihydro-2H-chromen-3-amine |
| SMILES | N[C@@H]1COc2c(ccc(Cl)c2F)C1 |
| InChI | InChI=1S/C9H9ClFNO/c10-7-2-1-5-3-6(12)4-13-9(5)8(7)11/h1-2,6H,3-4,12H2/t6-/m0/s1 |
| InChIKey | BEFIDVSUIJVFJI-LURJTMIESA-N |
| XLogP | 1.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |