C16H15Cl2NO2 — CID 129243893
7-[(2,6-dichlorophenyl)methoxy]-3,4-dihydro-2H-chromen-3-amine (PubChem CID 129243893) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 7-[(2,6-dichlorophenyl)methoxy]-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | 7-[(2,6-dichlorophenyl)methoxy]-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 129243893 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 7-[(2,6-dichlorophenyl)methoxy]-3,4-dihydro-2H-chromen-3-amine |
| SMILES | NC1COc2cc(OCc3c(Cl)cccc3Cl)ccc2C1 |
| InChI | InChI=1S/C16H15Cl2NO2/c17-14-2-1-3-15(18)13(14)9-20-12-5-4-10-6-11(19)8-21-16(10)7-12/h1-5,7,11H,6,8-9,19H2 |
| InChIKey | VLIIXUNRYJRRDM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |