C8H9ClN2O — CID 137480568
7-chloro-3,4-dihydro-2H-pyrano[3,2-c]pyridin-3-amine (PubChem CID 137480568) has the molecular formula C8H9ClN2O and a molecular weight of 184.63 g/mol. Its IUPAC name is 7-chloro-3,4-dihydro-2H-pyrano[3,2-c]pyridin-3-amine.
| Compound Name | 7-chloro-3,4-dihydro-2H-pyrano[3,2-c]pyridin-3-amine |
|---|---|
| PubChem CID | 137480568 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 7-chloro-3,4-dihydro-2H-pyrano[3,2-c]pyridin-3-amine |
| SMILES | NC1COc2cc(Cl)ncc2C1 |
| InChI | InChI=1S/C8H9ClN2O/c9-8-2-7-5(3-11-8)1-6(10)4-12-7/h2-3,6H,1,4,10H2 |
| InChIKey | ZZVFRENKQSBACQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|