C9H11ClN2 — CID 163219599
(3S)-7-chloro-3-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine (PubChem CID 163219599) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is (3S)-7-chloro-3-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine.
| Compound Name | (3S)-7-chloro-3-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 163219599 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (3S)-7-chloro-3-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine |
| SMILES | C[C@H]1Cc2cnc(Cl)cc2CN1 |
| InChI | InChI=1S/C9H11ClN2/c1-6-2-7-5-12-9(10)3-8(7)4-11-6/h3,5-6,11H,2,4H2,1H3/t6-/m0/s1 |
| InChIKey | VJCVZMMFLVIKMD-LURJTMIESA-N |
| XLogP | 1.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|