C8H8ClNO — CID 177205192
(3S)-6-chloro-3-methyl-1,3-dihydrofuro[3,4-c]pyridine (PubChem CID 177205192) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is (3S)-6-chloro-3-methyl-1,3-dihydrofuro[3,4-c]pyridine.
| Compound Name | (3S)-6-chloro-3-methyl-1,3-dihydrofuro[3,4-c]pyridine |
|---|---|
| PubChem CID | 177205192 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | (3S)-6-chloro-3-methyl-1,3-dihydrofuro[3,4-c]pyridine |
| SMILES | C[C@@H]1OCc2cc(Cl)ncc21 |
| InChI | InChI=1S/C8H8ClNO/c1-5-7-3-10-8(9)2-6(7)4-11-5/h2-3,5H,4H2,1H3/t5-/m0/s1 |
| InChIKey | WRCONVMMKSZOJT-YFKPBYRVSA-N |
| XLogP | 2.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|