C8H7ClO2 — CID 86339090
(1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol (PubChem CID 86339090) has the molecular formula C8H7ClO2 and a molecular weight of 170.59 g/mol. Its IUPAC name is (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol.
| Compound Name | (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol |
|---|---|
| PubChem CID | 86339090 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.59 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol |
| SMILES | O[C@H]1OCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C8H7ClO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,8,10H,4H2/t8-/m0/s1 |
| InChIKey | JUNJSGGYQNAEMA-QMMMGPOBSA-N |
| XLogP | 1.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |