About (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol
(1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol (PubChem CID 86339090) has the molecular formula C8H7ClO2
and a molecular weight of 170.59 g/mol. Its IUPAC name is (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol.
Molecular Properties
| Compound Name | (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol |
| PubChem CID | 86339090 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.59 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol |
| SMILES | O[C@H]1OCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C8H7ClO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,8,10H,4H2/t8-/m0/s1 |
| InChIKey | JUNJSGGYQNAEMA-QMMMGPOBSA-N |
| XLogP | 1.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol?
The IUPAC name of (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol (CID 86339090) is (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol.
What is the SMILES notation for (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol?
The canonical SMILES for (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol is O[C@H]1OCc2cc(Cl)ccc21.
What is the InChIKey of (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol?
The InChIKey is JUNJSGGYQNAEMA-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H7ClO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,8,10H,4H2/t8-/m0/s1.
What are the key properties of (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol?
(1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol has a molecular weight of 170.59 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-5-chloro-1,3-dihydro-2-benzofuran-1-ol is sourced from PubChem (CID 86339090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).