C9H10ClNO2 — CID 115062690
(6-chloro-4H-1,3-benzodioxin-2-yl)methanamine (PubChem CID 115062690) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-2-yl)methanamine.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-2-yl)methanamine |
|---|---|
| PubChem CID | 115062690 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-2-yl)methanamine |
| SMILES | NCC1OCc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C9H10ClNO2/c10-7-1-2-8-6(3-7)5-12-9(4-11)13-8/h1-3,9H,4-5,11H2 |
| InChIKey | IKQZCJQWSVAPCR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |