C10H12ClNO — CID 51600882
(1R,2R)-2-amino-6-chloro-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 51600882) has the molecular formula C10H12ClNO and a molecular weight of 197.67 g/mol. Its IUPAC name is (1R,2R)-2-amino-6-chloro-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R,2R)-2-amino-6-chloro-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 51600882 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (1R,2R)-2-amino-6-chloro-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | N[C@@H]1CCc2cc(Cl)ccc2[C@H]1O |
| InChI | InChI=1S/C10H12ClNO/c11-7-2-3-8-6(5-7)1-4-9(12)10(8)13/h2-3,5,9-10,13H,1,4,12H2/t9-,10-/m1/s1 |
| InChIKey | QUOYXBHYXUXVSL-NXEZZACHSA-N |
| XLogP | 1.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |