C14H19ClN2O — CID 84640322
6-chloro-2-piperazin-1-yl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 84640322) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 6-chloro-2-piperazin-1-yl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 6-chloro-2-piperazin-1-yl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 84640322 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-chloro-2-piperazin-1-yl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OC1c2ccc(Cl)cc2CCC1N1CCNCC1 |
| InChI | InChI=1S/C14H19ClN2O/c15-11-2-3-12-10(9-11)1-4-13(14(12)18)17-7-5-16-6-8-17/h2-3,9,13-14,16,18H,1,4-8H2 |
| InChIKey | SEZFZRBFIFTQID-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |