C15H18ClNO2 — CID 155073685
tert-butyl 3-[(6R)-3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl]prop-2-enoate (PubChem CID 155073685) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is tert-butyl 3-[(6R)-3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl]prop-2-enoate.
| Compound Name | tert-butyl 3-[(6R)-3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 155073685 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | tert-butyl 3-[(6R)-3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=C[C@H]1Cc2cnc(Cl)cc2C1 |
| InChI | InChI=1S/C15H18ClNO2/c1-15(2,3)19-14(18)5-4-10-6-11-8-13(16)17-9-12(11)7-10/h4-5,8-10H,6-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | ZZNDDOLAKLLLJY-SNVBAGLBSA-N |
| XLogP | 3.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|