C11H16F2O2 — CID 70914962
tert-butyl (E)-3-(3,3-difluorocyclobutyl)prop-2-enoate (PubChem CID 70914962) has the molecular formula C11H16F2O2 and a molecular weight of 218.24 g/mol. Its IUPAC name is tert-butyl (E)-3-(3,3-difluorocyclobutyl)prop-2-enoate.
| Compound Name | tert-butyl (E)-3-(3,3-difluorocyclobutyl)prop-2-enoate |
|---|---|
| PubChem CID | 70914962 |
| Molecular Formula | C11H16F2O2 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | tert-butyl (E)-3-(3,3-difluorocyclobutyl)prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C1CC(F)(F)C1 |
| InChI | InChI=1S/C11H16F2O2/c1-10(2,3)15-9(14)5-4-8-6-11(12,13)7-8/h4-5,8H,6-7H2,1-3H3/b5-4+ |
| InChIKey | SNGJXNDPYYDXHK-SNAWJCMRSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|