C14H22O2 — CID 167691364
tert-butyl (2E,4E)-5-(3-methylcyclobutyl)penta-2,4-dienoate (PubChem CID 167691364) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is tert-butyl (2E,4E)-5-(3-methylcyclobutyl)penta-2,4-dienoate.
| Compound Name | tert-butyl (2E,4E)-5-(3-methylcyclobutyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 167691364 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | tert-butyl (2E,4E)-5-(3-methylcyclobutyl)penta-2,4-dienoate |
| SMILES | CC1CC(/C=C/C=C/C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H22O2/c1-11-9-12(10-11)7-5-6-8-13(15)16-14(2,3)4/h5-8,11-12H,9-10H2,1-4H3/b7-5+,8-6+ |
| InChIKey | WZPZNNFBBRVCLO-KQQUZDAGSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|