About tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate
tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate (PubChem CID 154704227) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate |
| PubChem CID | 154704227 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C1CO1 |
| InChI | InChI=1S/C9H14O3/c1-9(2,3)12-8(10)5-4-7-6-11-7/h4-5,7H,6H2,1-3H3/b5-4+ |
| InChIKey | NHBQGYTXVOYMEB-SNAWJCMRSA-N |
| XLogP | 1.28 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate?
The IUPAC name of tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate (CID 154704227) is tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate.
What is the SMILES notation for tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate?
The canonical SMILES for tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate is CC(C)(C)OC(=O)/C=C/C1CO1.
What is the InChIKey of tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate?
The InChIKey is NHBQGYTXVOYMEB-SNAWJCMRSA-N. The full InChI is InChI=1S/C9H14O3/c1-9(2,3)12-8(10)5-4-7-6-11-7/h4-5,7H,6H2,1-3H3/b5-4+.
What are the key properties of tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate?
tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate has a molecular weight of 170.21 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-3-(oxiran-2-yl)prop-2-enoate is sourced from PubChem (CID 154704227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).