C15H26O6 — CID 102271983
tert-butyl (E)-3-[(2S,5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-enoate (PubChem CID 102271983) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is tert-butyl (E)-3-[(2S,5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(2S,5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102271983 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl (E)-3-[(2S,5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-enoate |
| SMILES | CO[C@@]1(C)OC[C@H](/C=C/C(=O)OC(C)(C)C)O[C@]1(C)OC |
| InChI | InChI=1S/C15H26O6/c1-13(2,3)21-12(16)9-8-11-10-19-14(4,17-6)15(5,18-7)20-11/h8-9,11H,10H2,1-7H3/b9-8+/t11-,14-,15-/m0/s1 |
| InChIKey | SLAPDHFUEDKYMT-KVOATBDBSA-N |
| XLogP | 2.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|