C15H23F2NO4 — CID 138732008
tert-butyl 5-(3-ethoxy-3-oxoprop-1-enyl)-3,3-difluoropiperidine-1-carboxylate (PubChem CID 138732008) has the molecular formula C15H23F2NO4 and a molecular weight of 319.35 g/mol. Its IUPAC name is tert-butyl 5-(3-ethoxy-3-oxoprop-1-enyl)-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 5-(3-ethoxy-3-oxoprop-1-enyl)-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 138732008 |
| Molecular Formula | C15H23F2NO4 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | tert-butyl 5-(3-ethoxy-3-oxoprop-1-enyl)-3,3-difluoropiperidine-1-carboxylate |
| SMILES | CCOC(=O)C=CC1CN(C(=O)OC(C)(C)C)CC(F)(F)C1 |
| InChI | InChI=1S/C15H23F2NO4/c1-5-21-12(19)7-6-11-8-15(16,17)10-18(9-11)13(20)22-14(2,3)4/h6-7,11H,5,8-10H2,1-4H3 |
| InChIKey | KRMXKJIFCIJJMR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|