C20H34N2O6 — CID 68769224
ditert-butyl 2-(3-ethoxy-3-oxoprop-1-enyl)-2-methylpiperazine-1,4-dicarboxylate (PubChem CID 68769224) has the molecular formula C20H34N2O6 and a molecular weight of 398.50 g/mol. Its IUPAC name is ditert-butyl 2-(3-ethoxy-3-oxoprop-1-enyl)-2-methylpiperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl 2-(3-ethoxy-3-oxoprop-1-enyl)-2-methylpiperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 68769224 |
| Molecular Formula | C20H34N2O6 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | ditert-butyl 2-(3-ethoxy-3-oxoprop-1-enyl)-2-methylpiperazine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C=CC1(C)CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34N2O6/c1-9-26-15(23)10-11-20(8)14-21(16(24)27-18(2,3)4)12-13-22(20)17(25)28-19(5,6)7/h10-11H,9,12-14H2,1-8H3 |
| InChIKey | NUZKCYXSNZTIIB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|