C18H32N2O5 — CID 118358736
ditert-butyl 2-(hydroxymethyl)-2-prop-2-enylpiperazine-1,4-dicarboxylate (PubChem CID 118358736) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is ditert-butyl 2-(hydroxymethyl)-2-prop-2-enylpiperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl 2-(hydroxymethyl)-2-prop-2-enylpiperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 118358736 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | ditert-butyl 2-(hydroxymethyl)-2-prop-2-enylpiperazine-1,4-dicarboxylate |
| SMILES | C=CCC1(CO)CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O5/c1-8-9-18(13-21)12-19(14(22)24-16(2,3)4)10-11-20(18)15(23)25-17(5,6)7/h8,21H,1,9-13H2,2-7H3 |
| InChIKey | ONHDHOKWIJRLRY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|