C18H32N2O7 — CID 170330703
1-O,4-O-ditert-butyl 2-O-methyl 2-(methoxymethyl)piperazine-1,2,4-tricarboxylate (PubChem CID 170330703) has the molecular formula C18H32N2O7 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-O,4-O-ditert-butyl 2-O-methyl 2-(methoxymethyl)piperazine-1,2,4-tricarboxylate.
| Compound Name | 1-O,4-O-ditert-butyl 2-O-methyl 2-(methoxymethyl)piperazine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 170330703 |
| Molecular Formula | C18H32N2O7 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-O,4-O-ditert-butyl 2-O-methyl 2-(methoxymethyl)piperazine-1,2,4-tricarboxylate |
| SMILES | COCC1(C(=O)OC)CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O7/c1-16(2,3)26-14(22)19-9-10-20(15(23)27-17(4,5)6)18(11-19,12-24-7)13(21)25-8/h9-12H2,1-8H3 |
| InChIKey | BGHXFITUDPSHGX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|