C13H17ClN2O2 — CID 83844719
tert-butyl 6-chloro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate (PubChem CID 83844719) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is tert-butyl 6-chloro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate.
| Compound Name | tert-butyl 6-chloro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 83844719 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | tert-butyl 6-chloro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(Cl)ncc2C1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-13(2,3)18-12(17)16-5-4-9-6-11(14)15-7-10(9)8-16/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | GAUKNFKNSBMOLU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|